C21H23N5O3 — CID 130372424
(2R,6S)-2-ethynyl-4-[6-[5-(2-methoxyethoxy)-1H-indazol-3-yl]pyrimidin-4-yl]-6-methylmorpholine (PubChem CID 130372424) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is (2R,6S)-2-ethynyl-4-[6-[5-(2-methoxyethoxy)-1H-indazol-3-yl]pyrimidin-4-yl]-6-methylmorpholine.
| Compound Name | (2R,6S)-2-ethynyl-4-[6-[5-(2-methoxyethoxy)-1H-indazol-3-yl]pyrimidin-4-yl]-6-methylmorpholine |
|---|---|
| PubChem CID | 130372424 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2R,6S)-2-ethynyl-4-[6-[5-(2-methoxyethoxy)-1H-indazol-3-yl]pyrimidin-4-yl]-6-methylmorpholine |
| SMILES | C#C[C@@H]1CN(c2cc(-c3n[nH]c4ccc(OCCOC)cc34)ncn2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H23N5O3/c1-4-15-12-26(11-14(2)29-15)20-10-19(22-13-23-20)21-17-9-16(28-8-7-27-3)5-6-18(17)24-25-21/h1,5-6,9-10,13-15H,7-8,11-12H2,2-3H3,(H,24,25)/t14-,15+/m0/s1 |
| InChIKey | UFVCJZDLXOMOKK-LSDHHAIUSA-N |
| XLogP | 2.27 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|