C22H25N5O2 — CID 144694912
(2S,6R)-2-ethenyl-6-methyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]morpholine (PubChem CID 144694912) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is (2S,6R)-2-ethenyl-6-methyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]morpholine.
| Compound Name | (2S,6R)-2-ethenyl-6-methyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 144694912 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2S,6R)-2-ethenyl-6-methyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]morpholine |
| SMILES | C=C[C@H]1CN(c2cc(-c3n[nH]c4ccc(OC5(C)CC5)cc34)ncn2)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H25N5O2/c1-4-15-12-27(11-14(2)28-15)20-10-19(23-13-24-20)21-17-9-16(29-22(3)7-8-22)5-6-18(17)25-26-21/h4-6,9-10,13-15H,1,7-8,11-12H2,2-3H3,(H,25,26)/t14-,15+/m1/s1 |
| InChIKey | QRWAXBYTRBTMMT-CABCVRRESA-N |
| XLogP | 3.73 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|