C25H27N7O2 — CID 163969210
2-[[(2S)-2-ethenyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]piperazin-1-yl]methyl]-1,3-oxazole (PubChem CID 163969210) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[[(2S)-2-ethenyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]piperazin-1-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[[(2S)-2-ethenyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]piperazin-1-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 163969210 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[[(2S)-2-ethenyl-4-[6-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]pyrimidin-4-yl]piperazin-1-yl]methyl]-1,3-oxazole |
| SMILES | C=C[C@H]1CN(c2cc(-c3n[nH]c4ccc(OC5(C)CC5)cc34)ncn2)CCN1Cc1ncco1 |
| InChI | InChI=1S/C25H27N7O2/c1-3-17-14-32(10-9-31(17)15-23-26-8-11-33-23)22-13-21(27-16-28-22)24-19-12-18(34-25(2)6-7-25)4-5-20(19)29-30-24/h3-5,8,11-13,16-17H,1,6-7,9-10,14-15H2,2H3,(H,29,30)/t17-/m0/s1 |
| InChIKey | SONAKNVPEMNQCF-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|