C18H26O3 — CID 130376605
(2R)-3-[4-(5,5-dimethyl-3-oxohexyl)phenyl]-2-methylpropanoic acid (PubChem CID 130376605) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2R)-3-[4-(5,5-dimethyl-3-oxohexyl)phenyl]-2-methylpropanoic acid.
| Compound Name | (2R)-3-[4-(5,5-dimethyl-3-oxohexyl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 130376605 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2R)-3-[4-(5,5-dimethyl-3-oxohexyl)phenyl]-2-methylpropanoic acid |
| SMILES | C[C@H](Cc1ccc(CCC(=O)CC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C18H26O3/c1-13(17(20)21)11-15-7-5-14(6-8-15)9-10-16(19)12-18(2,3)4/h5-8,13H,9-12H2,1-4H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | PAXRBBSGAVAOJE-CYBMUJFWSA-N |
| XLogP | 3.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |