C18H23N5O2 — CID 130377122
2-[4-(2,3-dihydro-1-benzofuran-6-ylmethyl)piperazin-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine (PubChem CID 130377122) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-6-ylmethyl)piperazin-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-6-ylmethyl)piperazin-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 130377122 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-6-ylmethyl)piperazin-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
| SMILES | c1cc2c(cc1CN1CCN(c3nc4n(n3)CCOC4)CC1)OCC2 |
| InChI | InChI=1S/C18H23N5O2/c1-2-15-3-9-25-16(15)11-14(1)12-21-4-6-22(7-5-21)18-19-17-13-24-10-8-23(17)20-18/h1-2,11H,3-10,12-13H2 |
| InChIKey | LCPATHZYJJYQNT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |