C20H26N5O2S- — CID 167102161
CID 167102161 (PubChem CID 167102161) has the molecular formula C20H26N5O2S- and a molecular weight of 400.53 g/mol.
| Compound Name | CID 167102161 |
|---|---|
| PubChem CID | 167102161 |
| Molecular Formula | C20H26N5O2S- |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | — |
| SMILES | CC(C)/N=[S-](=O)/c1cnc(N2CCN(Cc3ccc4c(c3)OCC4)CC2)nc1 |
| InChI | InChI=1S/C20H26N5O2S/c1-15(2)23-28(26)18-12-21-20(22-13-18)25-8-6-24(7-9-25)14-16-3-4-17-5-10-27-19(17)11-16/h3-4,11-13,15H,5-10,14H2,1-2H3/q-1 |
| InChIKey | NXCFZIWURHXGPO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|