C58H41N3O — CID 130379921
2,4-bis(3-phenylphenyl)-6-(4-spiro[3,4-dihydrofluorene-9,9'-8,8a-dihydroxanthene]-3'-ylphenyl)-1,3,5-triazine (PubChem CID 130379921) has the molecular formula C58H41N3O and a molecular weight of 795.99 g/mol. Its IUPAC name is 2,4-bis(3-phenylphenyl)-6-(4-spiro[3,4-dihydrofluorene-9,9'-8,8a-dihydroxanthene]-3'-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(3-phenylphenyl)-6-(4-spiro[3,4-dihydrofluorene-9,9'-8,8a-dihydroxanthene]-3'-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 130379921 |
| Molecular Formula | C58H41N3O |
| Molecular Weight | 795.99 g/mol |
| Exact Mass | 795.32 |
| IUPAC Name | 2,4-bis(3-phenylphenyl)-6-(4-spiro[3,4-dihydrofluorene-9,9'-8,8a-dihydroxanthene]-3'-ylphenyl)-1,3,5-triazine |
| SMILES | C1=CCC2C(=C1)Oc1cc(-c3ccc(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-c5cccc(-c6ccccc6)c5)n4)cc3)ccc1C21C2=C(CCC=C2)c2ccccc21 |
| InChI | InChI=1S/C58H41N3O/c1-3-15-38(16-4-1)42-19-13-21-45(35-42)56-59-55(60-57(61-56)46-22-14-20-43(36-46)39-17-5-2-6-18-39)41-31-29-40(30-32-41)44-33-34-52-54(37-44)62-53-28-12-11-27-51(53)58(52)49-25-9-7-23-47(49)48-24-8-10-26-50(48)58/h1-7,9-23,25-26,28-37,51H,8,24,27H2 |
| InChIKey | ZEGLCNMMNAYQCQ-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.99 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |