C14H27N3S — CID 130380781
4-[5-(6-methylheptyl)triazol-1-yl]butane-1-thiol (PubChem CID 130380781) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 4-[5-(6-methylheptyl)triazol-1-yl]butane-1-thiol.
| Compound Name | 4-[5-(6-methylheptyl)triazol-1-yl]butane-1-thiol |
|---|---|
| PubChem CID | 130380781 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-[5-(6-methylheptyl)triazol-1-yl]butane-1-thiol |
| SMILES | CC(C)CCCCCc1cnnn1CCCCS |
| InChI | InChI=1S/C14H27N3S/c1-13(2)8-4-3-5-9-14-12-15-16-17(14)10-6-7-11-18/h12-13,18H,3-11H2,1-2H3 |
| InChIKey | WEDZATZDISZGIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|