C17H33N3 — CID 130380893
1-(3,4-dimethylpentyl)-5-(6-methylheptyl)triazole (PubChem CID 130380893) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(3,4-dimethylpentyl)-5-(6-methylheptyl)triazole.
| Compound Name | 1-(3,4-dimethylpentyl)-5-(6-methylheptyl)triazole |
|---|---|
| PubChem CID | 130380893 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1-(3,4-dimethylpentyl)-5-(6-methylheptyl)triazole |
| SMILES | CC(C)CCCCCc1cnnn1CCC(C)C(C)C |
| InChI | InChI=1S/C17H33N3/c1-14(2)9-7-6-8-10-17-13-18-19-20(17)12-11-16(5)15(3)4/h13-16H,6-12H2,1-5H3 |
| InChIKey | VTCJMDITZFRJQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|