C13H23NO5 — CID 130383482
2-[formyl(2-propanoyloxyethyl)amino]ethyl 2,2-dimethylpropanoate (PubChem CID 130383482) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[formyl(2-propanoyloxyethyl)amino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[formyl(2-propanoyloxyethyl)amino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130383482 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[formyl(2-propanoyloxyethyl)amino]ethyl 2,2-dimethylpropanoate |
| SMILES | CCC(=O)OCCN(C=O)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H23NO5/c1-5-11(16)18-8-6-14(10-15)7-9-19-12(17)13(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | QBYJJCNSPHHVFU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|