C25H31N3O5S2 — CID 130383735
N-(4-hydroxy-2-methylphenyl)-2-methoxy-5-[4-methyl-2-[1-(oxan-4-yl)ethylamino]-1,3-thiazol-5-yl]benzenesulfonamide (PubChem CID 130383735) has the molecular formula C25H31N3O5S2 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-2-methoxy-5-[4-methyl-2-[1-(oxan-4-yl)ethylamino]-1,3-thiazol-5-yl]benzenesulfonamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-2-methoxy-5-[4-methyl-2-[1-(oxan-4-yl)ethylamino]-1,3-thiazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 130383735 |
| Molecular Formula | C25H31N3O5S2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-2-methoxy-5-[4-methyl-2-[1-(oxan-4-yl)ethylamino]-1,3-thiazol-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2sc(NC(C)C3CCOCC3)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1C |
| InChI | InChI=1S/C25H31N3O5S2/c1-15-13-20(29)6-7-21(15)28-35(30,31)23-14-19(5-8-22(23)32-4)24-17(3)27-25(34-24)26-16(2)18-9-11-33-12-10-18/h5-8,13-14,16,18,28-29H,9-12H2,1-4H3,(H,26,27) |
| InChIKey | GMSATXCDDPDFBJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|