C21H23N3O5S2 — CID 71549649
N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-methylpropanamide (PubChem CID 71549649) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71549649 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(-c2sc(NC(=O)C(C)C)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-12(2)20(26)23-21-22-13(3)19(30-21)14-5-10-17(29-4)18(11-14)31(27,28)24-15-6-8-16(25)9-7-15/h5-12,24-25H,1-4H3,(H,22,23,26) |
| InChIKey | BHCJYIZSPSELMV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|