C27H36N2O5S2 — CID 165078762
5-[2-(3,3-dimethyl-2-oxobutyl)-4-methyl-1,3-thiazol-5-yl]-N-(4-hydroxyphenyl)-2-methoxybenzenesulfonamide;2-methylpropane (PubChem CID 165078762) has the molecular formula C27H36N2O5S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 5-[2-(3,3-dimethyl-2-oxobutyl)-4-methyl-1,3-thiazol-5-yl]-N-(4-hydroxyphenyl)-2-methoxybenzenesulfonamide;2-methylpropane.
| Compound Name | 5-[2-(3,3-dimethyl-2-oxobutyl)-4-methyl-1,3-thiazol-5-yl]-N-(4-hydroxyphenyl)-2-methoxybenzenesulfonamide;2-methylpropane |
|---|---|
| PubChem CID | 165078762 |
| Molecular Formula | C27H36N2O5S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 5-[2-(3,3-dimethyl-2-oxobutyl)-4-methyl-1,3-thiazol-5-yl]-N-(4-hydroxyphenyl)-2-methoxybenzenesulfonamide;2-methylpropane |
| SMILES | CC(C)C.COc1ccc(-c2sc(CC(=O)C(C)(C)C)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C23H26N2O5S2.C4H10/c1-14-22(31-21(24-14)13-20(27)23(2,3)4)15-6-11-18(30-5)19(12-15)32(28,29)25-16-7-9-17(26)10-8-16;1-4(2)3/h6-12,25-26H,13H2,1-5H3;4H,1-3H3 |
| InChIKey | UTOKEKKWJDXPJN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|