C22H26N4O5S2 — CID 71548663
1-tert-butyl-3-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]urea (PubChem CID 71548663) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 1-tert-butyl-3-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 71548663 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 1-tert-butyl-3-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]urea |
| SMILES | COc1ccc(-c2sc(NC(=O)NC(C)(C)C)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H26N4O5S2/c1-13-19(32-21(23-13)24-20(28)25-22(2,3)4)14-6-11-17(31-5)18(12-14)33(29,30)26-15-7-9-16(27)10-8-15/h6-12,26-27H,1-5H3,(H2,23,24,25,28) |
| InChIKey | HAHNCUQCLUFNKC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|