C25H23N3O5S2 — CID 89493780
N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylacetamide (PubChem CID 89493780) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 89493780 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylacetamide |
| SMILES | COc1ccc(-c2sc(NC(=O)Cc3ccccc3)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C25H23N3O5S2/c1-16-24(34-25(26-16)27-23(30)14-17-6-4-3-5-7-17)18-8-13-21(33-2)22(15-18)35(31,32)28-19-9-11-20(29)12-10-19/h3-13,15,28-29H,14H2,1-2H3,(H,26,27,30) |
| InChIKey | HJEVTBAHBRYORH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|