C19H26N4O6S2 — CID 171783641
N-[5-[3-[[3-(hydroxyamino)-3-oxopropyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 171783641) has the molecular formula C19H26N4O6S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[5-[3-[[3-(hydroxyamino)-3-oxopropyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[3-[[3-(hydroxyamino)-3-oxopropyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 171783641 |
| Molecular Formula | C19H26N4O6S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[5-[3-[[3-(hydroxyamino)-3-oxopropyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(-c2sc(NC(=O)C(C)(C)C)nc2C)cc1S(=O)(=O)NCCC(=O)NO |
| InChI | InChI=1S/C19H26N4O6S2/c1-11-16(30-18(21-11)22-17(25)19(2,3)4)12-6-7-13(29-5)14(10-12)31(27,28)20-9-8-15(24)23-26/h6-7,10,20,26H,8-9H2,1-5H3,(H,23,24)(H,21,22,25) |
| InChIKey | DCMBCBCIQHSMKX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|