C21H30N4O6S2 — CID 171783638
5-[[5-[2-(2,2-dimethylpropanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxyphenyl]sulfonylamino]-N-hydroxypentanamide (PubChem CID 171783638) has the molecular formula C21H30N4O6S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 5-[[5-[2-(2,2-dimethylpropanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxyphenyl]sulfonylamino]-N-hydroxypentanamide.
| Compound Name | 5-[[5-[2-(2,2-dimethylpropanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxyphenyl]sulfonylamino]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 171783638 |
| Molecular Formula | C21H30N4O6S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 5-[[5-[2-(2,2-dimethylpropanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxyphenyl]sulfonylamino]-N-hydroxypentanamide |
| SMILES | COc1ccc(-c2sc(NC(=O)C(C)(C)C)nc2C)cc1S(=O)(=O)NCCCCC(=O)NO |
| InChI | InChI=1S/C21H30N4O6S2/c1-13-18(32-20(23-13)24-19(27)21(2,3)4)14-9-10-15(31-5)16(12-14)33(29,30)22-11-7-6-8-17(26)25-28/h9-10,12,22,28H,6-8,11H2,1-5H3,(H,25,26)(H,23,24,27) |
| InChIKey | MXEIKRUTMZNQRK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|