C26H33N3O5S2 — CID 154677931
N-[5-[3-[[4-hydroxy-3-(2-methylpropyl)phenyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 154677931) has the molecular formula C26H33N3O5S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is N-[5-[3-[[4-hydroxy-3-(2-methylpropyl)phenyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[3-[[4-hydroxy-3-(2-methylpropyl)phenyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 154677931 |
| Molecular Formula | C26H33N3O5S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-[5-[3-[[4-hydroxy-3-(2-methylpropyl)phenyl]sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(-c2sc(NC(=O)C(C)(C)C)nc2C)cc1S(=O)(=O)Nc1ccc(O)c(CC(C)C)c1 |
| InChI | InChI=1S/C26H33N3O5S2/c1-15(2)12-18-13-19(9-10-20(18)30)29-36(32,33)22-14-17(8-11-21(22)34-7)23-16(3)27-25(35-23)28-24(31)26(4,5)6/h8-11,13-15,29-30H,12H2,1-7H3,(H,27,28,31) |
| InChIKey | GCDBGSLKTMRCTL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|