C23H26N4O6S2 — CID 123508032
2-(hydroxymethyl)-N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide (PubChem CID 123508032) has the molecular formula C23H26N4O6S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(hydroxymethyl)-N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 123508032 |
| Molecular Formula | C23H26N4O6S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2-(hydroxymethyl)-N-[5-[3-[(4-hydroxyphenyl)sulfamoyl]-4-methoxyphenyl]-4-methyl-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(-c2sc(NC(=O)N3CCCC3CO)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C23H26N4O6S2/c1-14-21(34-22(24-14)25-23(30)27-11-3-4-17(27)13-28)15-5-10-19(33-2)20(12-15)35(31,32)26-16-6-8-18(29)9-7-16/h5-10,12,17,26,28-29H,3-4,11,13H2,1-2H3,(H,24,25,30) |
| InChIKey | IZWHLXLYYWTVDJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|