C19H23NO3S — CID 130387344
(1S)-14-(2-hydroxyethyl)-5-methoxy-15-thia-10-azatetracyclo[8.8.0.02,7.012,16]octadeca-2,4,6,12(16),13-pentaen-4-ol (PubChem CID 130387344) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is (1S)-14-(2-hydroxyethyl)-5-methoxy-15-thia-10-azatetracyclo[8.8.0.02,7.012,16]octadeca-2,4,6,12(16),13-pentaen-4-ol.
| Compound Name | (1S)-14-(2-hydroxyethyl)-5-methoxy-15-thia-10-azatetracyclo[8.8.0.02,7.012,16]octadeca-2,4,6,12(16),13-pentaen-4-ol |
|---|---|
| PubChem CID | 130387344 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (1S)-14-(2-hydroxyethyl)-5-methoxy-15-thia-10-azatetracyclo[8.8.0.02,7.012,16]octadeca-2,4,6,12(16),13-pentaen-4-ol |
| SMILES | COc1cc2c(cc1O)[C@@H]1CCc3sc(CCO)cc3CN1CC2 |
| InChI | InChI=1S/C19H23NO3S/c1-23-18-9-12-4-6-20-11-13-8-14(5-7-21)24-19(13)3-2-16(20)15(12)10-17(18)22/h8-10,16,21-22H,2-7,11H2,1H3/t16-/m0/s1 |
| InChIKey | RMKJAYUOPALZSP-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |