C22H28N2O2S — CID 166932839
(1S)-5-methoxy-14-(4-methylpentyl)-4-nitroso-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaene (PubChem CID 166932839) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is (1S)-5-methoxy-14-(4-methylpentyl)-4-nitroso-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaene.
| Compound Name | (1S)-5-methoxy-14-(4-methylpentyl)-4-nitroso-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaene |
|---|---|
| PubChem CID | 166932839 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (1S)-5-methoxy-14-(4-methylpentyl)-4-nitroso-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaene |
| SMILES | COc1cc2c(cc1N=O)[C@@H]1Cc3sc(CCCC(C)C)cc3CN1CC2 |
| InChI | InChI=1S/C22H28N2O2S/c1-14(2)5-4-6-17-9-16-13-24-8-7-15-10-21(26-3)19(23-25)11-18(15)20(24)12-22(16)27-17/h9-11,14,20H,4-8,12-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | KYJXWXGCCVPRPE-FQEVSTJZSA-N |
| XLogP | 5.79 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |