C14H21NO2S2 — CID 130395420
[2-methyl-2-(methyldisulfanyl)propyl] N-(4-ethylphenyl)carbamate (PubChem CID 130395420) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is [2-methyl-2-(methyldisulfanyl)propyl] N-(4-ethylphenyl)carbamate.
| Compound Name | [2-methyl-2-(methyldisulfanyl)propyl] N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 130395420 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [2-methyl-2-(methyldisulfanyl)propyl] N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OCC(C)(C)SSC)cc1 |
| InChI | InChI=1S/C14H21NO2S2/c1-5-11-6-8-12(9-7-11)15-13(16)17-10-14(2,3)19-18-4/h6-9H,5,10H2,1-4H3,(H,15,16) |
| InChIKey | QZLXILDIZDGKAM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|