About methyl 2-ethenylidenehexanoate
methyl 2-ethenylidenehexanoate (PubChem CID 13040307) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is methyl 2-ethenylidenehexanoate.
Molecular Properties
| Compound Name | methyl 2-ethenylidenehexanoate |
| PubChem CID | 13040307 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | methyl 2-ethenylidenehexanoate |
| SMILES | C=C=C(CCCC)C(=O)OC |
| InChI | InChI=1S/C9H14O2/c1-4-6-7-8(5-2)9(10)11-3/h2,4,6-7H2,1,3H3 |
| InChIKey | VNGZWBRMFOQVQF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethenylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethenylidenehexanoate?
The IUPAC name of methyl 2-ethenylidenehexanoate (CID 13040307) is methyl 2-ethenylidenehexanoate.
What is the SMILES notation for methyl 2-ethenylidenehexanoate?
The canonical SMILES for methyl 2-ethenylidenehexanoate is C=C=C(CCCC)C(=O)OC.
What is the InChIKey of methyl 2-ethenylidenehexanoate?
The InChIKey is VNGZWBRMFOQVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-4-6-7-8(5-2)9(10)11-3/h2,4,6-7H2,1,3H3.
What are the key properties of methyl 2-ethenylidenehexanoate?
methyl 2-ethenylidenehexanoate has a molecular weight of 154.21 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethenylidenehexanoate is sourced from PubChem (CID 13040307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).