C17H26N2O3S — CID 130403292
2-[[(3R)-3-aminooxypiperidin-1-yl]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130403292) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-[[(3R)-3-aminooxypiperidin-1-yl]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[[(3R)-3-aminooxypiperidin-1-yl]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130403292 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[[(3R)-3-aminooxypiperidin-1-yl]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CC1(C)CCc2sc(CN3CCC[C@@H](ON)C3)c(C(=O)O)c2C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2)6-5-13-12(8-17)15(16(20)21)14(23-13)10-19-7-3-4-11(9-19)22-18/h11H,3-10,18H2,1-2H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | DKWOMUPGKKUXHJ-LLVKDONJSA-N |
| XLogP | 2.82 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|