C22H28N2O3S — CID 130403362
2-[2-[(3R)-3-aminooxypiperidin-1-yl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130403362) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[2-[(3R)-3-aminooxypiperidin-1-yl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[2-[(3R)-3-aminooxypiperidin-1-yl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130403362 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[2-[(3R)-3-aminooxypiperidin-1-yl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CC1(C)CCc2sc(-c3ccccc3N3CCC[C@@H](ON)C3)c(C(=O)O)c2C1 |
| InChI | InChI=1S/C22H28N2O3S/c1-22(2)10-9-18-16(12-22)19(21(25)26)20(28-18)15-7-3-4-8-17(15)24-11-5-6-14(13-24)27-23/h3-4,7-8,14H,5-6,9-13,23H2,1-2H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | AJKJDVXGWBGAFI-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|