C18H27N3O3S — CID 130403562
2-[(2S)-2-(hydrazinylmethyl)piperidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130403562) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[(2S)-2-(hydrazinylmethyl)piperidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[(2S)-2-(hydrazinylmethyl)piperidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130403562 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-[(2S)-2-(hydrazinylmethyl)piperidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CC1(C)CCc2sc(C(=O)N3CCCC[C@H]3CNN)c(C(=O)O)c2C1 |
| InChI | InChI=1S/C18H27N3O3S/c1-18(2)7-6-13-12(9-18)14(17(23)24)15(25-13)16(22)21-8-4-3-5-11(21)10-20-19/h11,20H,3-10,19H2,1-2H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | NAWNIJOKXKETSI-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|