C10H16N2O — CID 130403843
(E,4Z)-N,2-dimethyl-4-[(methylideneamino)methylidene]hex-2-enamide (PubChem CID 130403843) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (E,4Z)-N,2-dimethyl-4-[(methylideneamino)methylidene]hex-2-enamide.
| Compound Name | (E,4Z)-N,2-dimethyl-4-[(methylideneamino)methylidene]hex-2-enamide |
|---|---|
| PubChem CID | 130403843 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (E,4Z)-N,2-dimethyl-4-[(methylideneamino)methylidene]hex-2-enamide |
| SMILES | C=N/C=C(\C=C(/C)C(=O)NC)CC |
| InChI | InChI=1S/C10H16N2O/c1-5-9(7-11-3)6-8(2)10(13)12-4/h6-7H,3,5H2,1-2,4H3,(H,12,13)/b8-6+,9-7- |
| InChIKey | GBJBWTJFOGTVNX-FFELTBSMSA-N |
| XLogP | 1.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|