C19H23NO2 — CID 130406647
2-(cyclopropylmethylamino)-1-(4-phenylmethoxyphenyl)ethanol (PubChem CID 130406647) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-1-(4-phenylmethoxyphenyl)ethanol.
| Compound Name | 2-(cyclopropylmethylamino)-1-(4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 130406647 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(cyclopropylmethylamino)-1-(4-phenylmethoxyphenyl)ethanol |
| SMILES | OC(CNCC1CC1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO2/c21-19(13-20-12-15-6-7-15)17-8-10-18(11-9-17)22-14-16-4-2-1-3-5-16/h1-5,8-11,15,19-21H,6-7,12-14H2 |
| InChIKey | YZULQLIHFONMHK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |