C18H30ClNO4 — CID 13040903
propyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride (PubChem CID 13040903) has the molecular formula C18H30ClNO4 and a molecular weight of 359.89 g/mol. Its IUPAC name is propyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride.
| Compound Name | propyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 13040903 |
| Molecular Formula | C18H30ClNO4 |
| Molecular Weight | 359.89 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | propyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride |
| SMILES | CCCOC(=O)CCc1ccc(OCC(O)CNC(C)C)cc1.Cl |
| InChI | InChI=1S/C18H29NO4.ClH/c1-4-11-22-18(21)10-7-15-5-8-17(9-6-15)23-13-16(20)12-19-14(2)3;/h5-6,8-9,14,16,19-20H,4,7,10-13H2,1-3H3;1H |
| InChIKey | CLJYZAPZKXKQSW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.89 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |