C32H59NO15S4 — CID 130409264
[2-[2-aminooxy-3-[3-[1,3-bis(3-sulfanylpropanoyloxy)propan-2-yloxy]-2-[3-hydroxy-2-(3-sulfanylpropanoyloxy)propoxy]propoxy]propoxy]-3-(3-methylbutoxy)propyl] 3-sulfanylpropanoate (PubChem CID 130409264) has the molecular formula C32H59NO15S4 and a molecular weight of 826.08 g/mol. Its IUPAC name is [2-[2-aminooxy-3-[3-[1,3-bis(3-sulfanylpropanoyloxy)propan-2-yloxy]-2-[3-hydroxy-2-(3-sulfanylpropanoyloxy)propoxy]propoxy]propoxy]-3-(3-methylbutoxy)propyl] 3-sulfanylpropanoate.
| Compound Name | [2-[2-aminooxy-3-[3-[1,3-bis(3-sulfanylpropanoyloxy)propan-2-yloxy]-2-[3-hydroxy-2-(3-sulfanylpropanoyloxy)propoxy]propoxy]propoxy]-3-(3-methylbutoxy)propyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 130409264 |
| Molecular Formula | C32H59NO15S4 |
| Molecular Weight | 826.08 g/mol |
| Exact Mass | 825.28 |
| IUPAC Name | [2-[2-aminooxy-3-[3-[1,3-bis(3-sulfanylpropanoyloxy)propan-2-yloxy]-2-[3-hydroxy-2-(3-sulfanylpropanoyloxy)propoxy]propoxy]propoxy]-3-(3-methylbutoxy)propyl] 3-sulfanylpropanoate |
| SMILES | CC(C)CCOCC(COC(=O)CCS)OCC(COCC(COC(COC(=O)CCS)COC(=O)CCS)OCC(CO)OC(=O)CCS)ON |
| InChI | InChI=1S/C32H59NO15S4/c1-23(2)3-8-39-14-25(19-44-29(35)4-9-49)43-22-28(48-33)16-40-15-26(41-17-24(13-34)47-32(38)7-12-52)18-42-27(20-45-30(36)5-10-50)21-46-31(37)6-11-51/h23-28,34,49-52H,3-22,33H2,1-2H3 |
| InChIKey | DWGRYLPJOCTNIE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 206.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.08 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|