C39H54F2O13S — CID 130409944
2-[[3-[5,5-bis[(3-formylbicyclo[3.3.1]nonane-1-carbonyl)oxymethyl]-1,3-dioxan-2-yl]-1-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 130409944) has the molecular formula C39H54F2O13S and a molecular weight of 800.91 g/mol. Its IUPAC name is 2-[[3-[5,5-bis[(3-formylbicyclo[3.3.1]nonane-1-carbonyl)oxymethyl]-1,3-dioxan-2-yl]-1-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[3-[5,5-bis[(3-formylbicyclo[3.3.1]nonane-1-carbonyl)oxymethyl]-1,3-dioxan-2-yl]-1-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 130409944 |
| Molecular Formula | C39H54F2O13S |
| Molecular Weight | 800.91 g/mol |
| Exact Mass | 800.33 |
| IUPAC Name | 2-[[3-[5,5-bis[(3-formylbicyclo[3.3.1]nonane-1-carbonyl)oxymethyl]-1,3-dioxan-2-yl]-1-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=CC1CC2CCCC(C(=O)OCC3(COC(=O)C45CCCC(CC(C=O)C4)C5)COC(C4CC5CCCC(OC(=O)C(F)(F)S(=O)(=O)O)(C5)C4)OC3)(C1)C2 |
| InChI | InChI=1S/C39H54F2O13S/c40-39(41,55(47,48)49)34(46)54-38-9-3-6-27(17-38)12-30(18-38)31-50-21-35(22-51-31,23-52-32(44)36-7-1-4-25(13-36)10-28(15-36)19-42)24-53-33(45)37-8-2-5-26(14-37)11-29(16-37)20-43/h19-20,25-31H,1-18,21-24H2,(H,47,48,49) |
| InChIKey | BXXBRSKWEJYIGO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|