C27H32I2O2 — CID 130410710
2,6-dicyclohexyl-4-[3-iodo-5-(1-iodopropyl)-4-oxocyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-one (PubChem CID 130410710) has the molecular formula C27H32I2O2 and a molecular weight of 642.36 g/mol. Its IUPAC name is 2,6-dicyclohexyl-4-[3-iodo-5-(1-iodopropyl)-4-oxocyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-dicyclohexyl-4-[3-iodo-5-(1-iodopropyl)-4-oxocyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 130410710 |
| Molecular Formula | C27H32I2O2 |
| Molecular Weight | 642.36 g/mol |
| Exact Mass | 642.05 |
| IUPAC Name | 2,6-dicyclohexyl-4-[3-iodo-5-(1-iodopropyl)-4-oxocyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CCC(I)C1=CC(=C2C=C(C3CCCCC3)C(=O)C(C3CCCCC3)=C2)C=C(I)C1=O |
| InChI | InChI=1S/C27H32I2O2/c1-2-24(28)23-15-20(16-25(29)27(23)31)19-13-21(17-9-5-3-6-10-17)26(30)22(14-19)18-11-7-4-8-12-18/h13-18,24H,2-12H2,1H3 |
| InChIKey | ILPJCEIYXPUGIF-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.36 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|