C24H44O3 — CID 130414729
1-(dimethoxymethyl)-4-[4-(4-propoxycyclohexyl)cyclohexyl]cyclohexane (PubChem CID 130414729) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is 1-(dimethoxymethyl)-4-[4-(4-propoxycyclohexyl)cyclohexyl]cyclohexane.
| Compound Name | 1-(dimethoxymethyl)-4-[4-(4-propoxycyclohexyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 130414729 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 1-(dimethoxymethyl)-4-[4-(4-propoxycyclohexyl)cyclohexyl]cyclohexane |
| SMILES | CCCOC1CCC(C2CCC(C3CCC(C(OC)OC)CC3)CC2)CC1 |
| InChI | InChI=1S/C24H44O3/c1-4-17-27-23-15-13-21(14-16-23)19-7-5-18(6-8-19)20-9-11-22(12-10-20)24(25-2)26-3/h18-24H,4-17H2,1-3H3 |
| InChIKey | BPVNQHDNIDGCJC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|