C13H24O2 — CID 154554041
2-(dimethoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 154554041) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(dimethoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 154554041 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-(dimethoxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | COC(OC)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C13H24O2/c1-14-13(15-2)12-8-7-10-5-3-4-6-11(10)9-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | JVPQUBOOUWRWKG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|