C19H33NO — CID 130415405
(2R,4E,6Z)-4-ethyl-3-[(3Z)-hexa-1,3-dien-2-yl]-1-(propan-2-ylamino)octa-4,6-dien-2-ol (PubChem CID 130415405) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (2R,4E,6Z)-4-ethyl-3-[(3Z)-hexa-1,3-dien-2-yl]-1-(propan-2-ylamino)octa-4,6-dien-2-ol.
| Compound Name | (2R,4E,6Z)-4-ethyl-3-[(3Z)-hexa-1,3-dien-2-yl]-1-(propan-2-ylamino)octa-4,6-dien-2-ol |
|---|---|
| PubChem CID | 130415405 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (2R,4E,6Z)-4-ethyl-3-[(3Z)-hexa-1,3-dien-2-yl]-1-(propan-2-ylamino)octa-4,6-dien-2-ol |
| SMILES | C=C(/C=C\CC)C(/C(=C/C=C\C)CC)[C@@H](O)CNC(C)C |
| InChI | InChI=1S/C19H33NO/c1-7-10-12-16(6)19(17(9-3)13-11-8-2)18(21)14-20-15(4)5/h8,10-13,15,18-21H,6-7,9,14H2,1-5H3/b11-8-,12-10-,17-13+/t18-,19?/m0/s1 |
| InChIKey | XAXORIFXEDOHKP-VIHSAVTGSA-N |
| XLogP | 4.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|