C22H26N2O — CID 130416499
2-benzhydryl-9-methyl-2,9-diazaspiro[4.5]decan-6-one (PubChem CID 130416499) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-benzhydryl-9-methyl-2,9-diazaspiro[4.5]decan-6-one.
| Compound Name | 2-benzhydryl-9-methyl-2,9-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 130416499 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-benzhydryl-9-methyl-2,9-diazaspiro[4.5]decan-6-one |
| SMILES | CN1CCC(=O)C2(CCN(C(c3ccccc3)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C22H26N2O/c1-23-14-12-20(25)22(16-23)13-15-24(17-22)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,21H,12-17H2,1H3 |
| InChIKey | BXPPARZQSMWHAV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |