About 3-acetyl-1,3-dimethylpiperidin-4-one;toluene
3-acetyl-1,3-dimethylpiperidin-4-one;toluene (PubChem CID 158773280) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-acetyl-1,3-dimethylpiperidin-4-one;toluene.
Molecular Properties
| Compound Name | 3-acetyl-1,3-dimethylpiperidin-4-one;toluene |
| PubChem CID | 158773280 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-acetyl-1,3-dimethylpiperidin-4-one;toluene |
| SMILES | CC(=O)C1(C)CN(C)CCC1=O.Cc1ccccc1 |
| InChI | InChI=1S/C9H15NO2.C7H8/c1-7(11)9(2)6-10(3)5-4-8(9)12;1-7-5-3-2-4-6-7/h4-6H2,1-3H3;2-6H,1H3 |
| InChIKey | IQDLOMLUZWJEKZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-1,3-dimethylpiperidin-4-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1,3-dimethylpiperidin-4-one;toluene?
The IUPAC name of 3-acetyl-1,3-dimethylpiperidin-4-one;toluene (CID 158773280) is 3-acetyl-1,3-dimethylpiperidin-4-one;toluene.
What is the SMILES notation for 3-acetyl-1,3-dimethylpiperidin-4-one;toluene?
The canonical SMILES for 3-acetyl-1,3-dimethylpiperidin-4-one;toluene is CC(=O)C1(C)CN(C)CCC1=O.Cc1ccccc1.
What is the InChIKey of 3-acetyl-1,3-dimethylpiperidin-4-one;toluene?
The InChIKey is IQDLOMLUZWJEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C7H8/c1-7(11)9(2)6-10(3)5-4-8(9)12;1-7-5-3-2-4-6-7/h4-6H2,1-3H3;2-6H,1H3.
What are the key properties of 3-acetyl-1,3-dimethylpiperidin-4-one;toluene?
3-acetyl-1,3-dimethylpiperidin-4-one;toluene has a molecular weight of 261.37 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1,3-dimethylpiperidin-4-one;toluene is sourced from PubChem (CID 158773280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).