About acetyl(trimethyl)azanium;toluene;bromide
acetyl(trimethyl)azanium;toluene;bromide (PubChem CID 174919648) has the molecular formula C12H20BrNO
and a molecular weight of 274.20 g/mol. Its IUPAC name is acetyl(trimethyl)azanium;toluene;bromide.
Molecular Properties
| Compound Name | acetyl(trimethyl)azanium;toluene;bromide |
| PubChem CID | 174919648 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | acetyl(trimethyl)azanium;toluene;bromide |
| SMILES | CC(=O)[N+](C)(C)C.Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C7H8.C5H12NO.BrH/c1-7-5-3-2-4-6-7;1-5(7)6(2,3)4;/h2-6H,1H3;1-4H3;1H/q;+1;/p-1 |
| InChIKey | OTKKNMLYRKVMKV-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze acetyl(trimethyl)azanium;toluene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(trimethyl)azanium;toluene;bromide?
The IUPAC name of acetyl(trimethyl)azanium;toluene;bromide (CID 174919648) is acetyl(trimethyl)azanium;toluene;bromide.
What is the SMILES notation for acetyl(trimethyl)azanium;toluene;bromide?
The canonical SMILES for acetyl(trimethyl)azanium;toluene;bromide is CC(=O)[N+](C)(C)C.Cc1ccccc1.[Br-].
What is the InChIKey of acetyl(trimethyl)azanium;toluene;bromide?
The InChIKey is OTKKNMLYRKVMKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8.C5H12NO.BrH/c1-7-5-3-2-4-6-7;1-5(7)6(2,3)4;/h2-6H,1H3;1-4H3;1H/q;+1;/p-1.
What are the key properties of acetyl(trimethyl)azanium;toluene;bromide?
acetyl(trimethyl)azanium;toluene;bromide has a molecular weight of 274.20 g/mol, XLogP of -0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(trimethyl)azanium;toluene;bromide is sourced from PubChem (CID 174919648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).