C8H12N2 — CID 130419040
7-ethyl-2-methyl-5H-1,4-diazepine (PubChem CID 130419040) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 7-ethyl-2-methyl-5H-1,4-diazepine.
| Compound Name | 7-ethyl-2-methyl-5H-1,4-diazepine |
|---|---|
| PubChem CID | 130419040 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 7-ethyl-2-methyl-5H-1,4-diazepine |
| SMILES | CCC1=CCN=CC(C)=N1 |
| InChI | InChI=1S/C8H12N2/c1-3-8-4-5-9-6-7(2)10-8/h4,6H,3,5H2,1-2H3 |
| InChIKey | WCDAXPHXPUDUBP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |