C30H51N7O6S — CID 130425523
[3-[4-[[(3S)-4-hydrazinyl-3-methyl-4-oxobutyl]carbamoyl]-1,3-thiazol-2-yl]propyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]pentanoyl]amino]methyl butanoate (PubChem CID 130425523) has the molecular formula C30H51N7O6S and a molecular weight of 637.85 g/mol. Its IUPAC name is [3-[4-[[(3S)-4-hydrazinyl-3-methyl-4-oxobutyl]carbamoyl]-1,3-thiazol-2-yl]propyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]pentanoyl]amino]methyl butanoate.
| Compound Name | [3-[4-[[(3S)-4-hydrazinyl-3-methyl-4-oxobutyl]carbamoyl]-1,3-thiazol-2-yl]propyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]pentanoyl]amino]methyl butanoate |
|---|---|
| PubChem CID | 130425523 |
| Molecular Formula | C30H51N7O6S |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | [3-[4-[[(3S)-4-hydrazinyl-3-methyl-4-oxobutyl]carbamoyl]-1,3-thiazol-2-yl]propyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]pentanoyl]amino]methyl butanoate |
| SMILES | CCCC(=O)OCN(CCCc1nc(C(=O)NCC[C@H](C)C(=O)NN)cs1)C(=O)C(NC(=O)[C@H]1CCCCN1C)C(C)CC |
| InChI | InChI=1S/C30H51N7O6S/c1-6-11-25(38)43-19-37(30(42)26(20(3)7-2)34-29(41)23-12-8-9-16-36(23)5)17-10-13-24-33-22(18-44-24)28(40)32-15-14-21(4)27(39)35-31/h18,20-21,23,26H,6-17,19,31H2,1-5H3,(H,32,40)(H,34,41)(H,35,39)/t20?,21-,23+,26?/m0/s1 |
| InChIKey | ZRZBGTOFQQTGTF-WOHKMTIZSA-N |
| XLogP | 1.97 |
| TPSA | 176.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|