C22H39N3O5S — CID 145149148
methyl 2-[3-[(2-amino-3-methylpentanoyl)-(butanoyloxymethyl)amino]propyl]-1,3-thiazole-4-carboxylate;propane (PubChem CID 145149148) has the molecular formula C22H39N3O5S and a molecular weight of 457.64 g/mol. Its IUPAC name is methyl 2-[3-[(2-amino-3-methylpentanoyl)-(butanoyloxymethyl)amino]propyl]-1,3-thiazole-4-carboxylate;propane.
| Compound Name | methyl 2-[3-[(2-amino-3-methylpentanoyl)-(butanoyloxymethyl)amino]propyl]-1,3-thiazole-4-carboxylate;propane |
|---|---|
| PubChem CID | 145149148 |
| Molecular Formula | C22H39N3O5S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | methyl 2-[3-[(2-amino-3-methylpentanoyl)-(butanoyloxymethyl)amino]propyl]-1,3-thiazole-4-carboxylate;propane |
| SMILES | CCC.CCCC(=O)OCN(CCCc1nc(C(=O)OC)cs1)C(=O)C(N)C(C)CC |
| InChI | InChI=1S/C19H31N3O5S.C3H8/c1-5-8-16(23)27-12-22(18(24)17(20)13(3)6-2)10-7-9-15-21-14(11-28-15)19(25)26-4;1-3-2/h11,13,17H,5-10,12,20H2,1-4H3;3H2,1-2H3 |
| InChIKey | RNABJZGTTFBGAO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|