C26H27ClN6O2 — CID 130425615
N-[(2E,4E)-4-(6-chloro-5-morpholin-4-yl-3-pyridinyl)-5-(methylideneamino)hexa-2,4-dien-2-yl]-2-(1-cyanocyclopropyl)pyridine-4-carboxamide (PubChem CID 130425615) has the molecular formula C26H27ClN6O2 and a molecular weight of 491.00 g/mol. Its IUPAC name is N-[(2E,4E)-4-(6-chloro-5-morpholin-4-yl-3-pyridinyl)-5-(methylideneamino)hexa-2,4-dien-2-yl]-2-(1-cyanocyclopropyl)pyridine-4-carboxamide.
| Compound Name | N-[(2E,4E)-4-(6-chloro-5-morpholin-4-yl-3-pyridinyl)-5-(methylideneamino)hexa-2,4-dien-2-yl]-2-(1-cyanocyclopropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130425615 |
| Molecular Formula | C26H27ClN6O2 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[(2E,4E)-4-(6-chloro-5-morpholin-4-yl-3-pyridinyl)-5-(methylideneamino)hexa-2,4-dien-2-yl]-2-(1-cyanocyclopropyl)pyridine-4-carboxamide |
| SMILES | C=N/C(C)=C(\C=C(/C)NC(=O)c1ccnc(C2(C#N)CC2)c1)c1cnc(Cl)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C26H27ClN6O2/c1-17(32-25(34)19-4-7-30-23(14-19)26(16-28)5-6-26)12-21(18(2)29-3)20-13-22(24(27)31-15-20)33-8-10-35-11-9-33/h4,7,12-15H,3,5-6,8-11H2,1-2H3,(H,32,34)/b17-12+,21-18+ |
| InChIKey | NHOYZBKIUMXDQC-ITQKOXSASA-N |
| XLogP | 4.29 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|