C26H27N7O2 — CID 130428946
2-(1-cyanocyclopropyl)-N-[5-[(2E,4E)-4-cyano-5-(2-methoxyethylamino)-5-(methylideneamino)penta-2,4-dien-2-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 130428946) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-(1-cyanocyclopropyl)-N-[5-[(2E,4E)-4-cyano-5-(2-methoxyethylamino)-5-(methylideneamino)penta-2,4-dien-2-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-(1-cyanocyclopropyl)-N-[5-[(2E,4E)-4-cyano-5-(2-methoxyethylamino)-5-(methylideneamino)penta-2,4-dien-2-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130428946 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-(1-cyanocyclopropyl)-N-[5-[(2E,4E)-4-cyano-5-(2-methoxyethylamino)-5-(methylideneamino)penta-2,4-dien-2-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | C=N/C(NCCOC)=C(C#N)\C=C(/C)c1cc(NC(=O)c2ccnc(C3(C#N)CC3)c2)cnc1C |
| InChI | InChI=1S/C26H27N7O2/c1-17(11-20(14-27)24(29-3)31-9-10-35-4)22-13-21(15-32-18(22)2)33-25(34)19-5-8-30-23(12-19)26(16-28)6-7-26/h5,8,11-13,15,31H,3,6-7,9-10H2,1-2,4H3,(H,33,34)/b17-11+,24-20- |
| InChIKey | ZHZQWAOYXRFIRX-WJTNBJAWSA-N |
| XLogP | 3.67 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|