C17H37NO2 — CID 130426560
3-(7-methyltridecan-7-ylamino)propane-1,2-diol (PubChem CID 130426560) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is 3-(7-methyltridecan-7-ylamino)propane-1,2-diol.
| Compound Name | 3-(7-methyltridecan-7-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 130426560 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | 3-(7-methyltridecan-7-ylamino)propane-1,2-diol |
| SMILES | CCCCCCC(C)(CCCCCC)NCC(O)CO |
| InChI | InChI=1S/C17H37NO2/c1-4-6-8-10-12-17(3,13-11-9-7-5-2)18-14-16(20)15-19/h16,18-20H,4-15H2,1-3H3 |
| InChIKey | ZMTWWQQKTKGCKV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|