C18H38O2 — CID 139372551
4-hexyl-4-methylundecane-1,2-diol (PubChem CID 139372551) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 4-hexyl-4-methylundecane-1,2-diol.
| Compound Name | 4-hexyl-4-methylundecane-1,2-diol |
|---|---|
| PubChem CID | 139372551 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 4-hexyl-4-methylundecane-1,2-diol |
| SMILES | CCCCCCCC(C)(CCCCCC)CC(O)CO |
| InChI | InChI=1S/C18H38O2/c1-4-6-8-10-12-14-18(3,15-17(20)16-19)13-11-9-7-5-2/h17,19-20H,4-16H2,1-3H3 |
| InChIKey | SIXNQBKZXDHBSR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|