C17H22F11NO — CID 130427295
1-[1,1,1,3,3-pentafluoro-3-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propan-2-yl]azepane (PubChem CID 130427295) has the molecular formula C17H22F11NO and a molecular weight of 465.35 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-3-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propan-2-yl]azepane.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-3-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propan-2-yl]azepane |
|---|---|
| PubChem CID | 130427295 |
| Molecular Formula | C17H22F11NO |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-3-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propan-2-yl]azepane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCCC(C(F)(F)C(N2CCCCCC2)C(F)(F)F)O1 |
| InChI | InChI=1S/C17H22F11NO/c18-12(16(23,24)25)14(19,20)10-6-5-7-11(30-10)15(21,22)13(17(26,27)28)29-8-3-1-2-4-9-29/h10-13H,1-9H2 |
| InChIKey | VBPPPCSTNAJXOR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |