C23H19BrFN3O3S2 — CID 130428050
N-(4-bromophenyl)sulfonyl-4-[2-(4-fluorophenyl)-4-imino-1,3-thiazolidin-3-yl]-3-methylbenzamide (PubChem CID 130428050) has the molecular formula C23H19BrFN3O3S2 and a molecular weight of 548.46 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-4-[2-(4-fluorophenyl)-4-imino-1,3-thiazolidin-3-yl]-3-methylbenzamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-4-[2-(4-fluorophenyl)-4-imino-1,3-thiazolidin-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 130428050 |
| Molecular Formula | C23H19BrFN3O3S2 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-4-[2-(4-fluorophenyl)-4-imino-1,3-thiazolidin-3-yl]-3-methylbenzamide |
| SMILES | [H]/N=C1\CSC(c2ccc(F)cc2)N1c1ccc(C(=O)NS(=O)(=O)c2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C23H19BrFN3O3S2/c1-14-12-16(22(29)27-33(30,31)19-9-5-17(24)6-10-19)4-11-20(14)28-21(26)13-32-23(28)15-2-7-18(25)8-3-15/h2-12,23,26H,13H2,1H3,(H,27,29)/b26-21+ |
| InChIKey | MZVZCRBHJDWVCE-YYADALCUSA-N |
| XLogP | 5.24 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|