C30H34ClN3O3 — CID 130430287
(3S)-6-[chloro-[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-2,3-dimethyl-9-phenylmethoxy-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione (PubChem CID 130430287) has the molecular formula C30H34ClN3O3 and a molecular weight of 520.07 g/mol. Its IUPAC name is (3S)-6-[chloro-[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-2,3-dimethyl-9-phenylmethoxy-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione.
| Compound Name | (3S)-6-[chloro-[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-2,3-dimethyl-9-phenylmethoxy-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
|---|---|
| PubChem CID | 130430287 |
| Molecular Formula | C30H34ClN3O3 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (3S)-6-[chloro-[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-2,3-dimethyl-9-phenylmethoxy-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
| SMILES | Cc1cc(C)cc(C2(C(Cl)c3nc(=O)c(OCc4ccccc4)c4n3C[C@H](C)N(C)C4=O)CCCC2)c1 |
| InChI | InChI=1S/C30H34ClN3O3/c1-19-14-20(2)16-23(15-19)30(12-8-9-13-30)26(31)27-32-28(35)25(37-18-22-10-6-5-7-11-22)24-29(36)33(4)21(3)17-34(24)27/h5-7,10-11,14-16,21,26H,8-9,12-13,17-18H2,1-4H3/t21-,26?/m0/s1 |
| InChIKey | XPGSGFLXWHMNEO-GVNKFJBHSA-N |
| XLogP | 5.71 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|