C25H31N3O5 — CID 130430341
[[1-(3,5-dimethylphenyl)cyclopentyl]-[(3S)-9-hydroxy-2,3-dimethyl-1,8-dioxo-3,4-dihydropyrazino[1,2-c]pyrimidin-6-yl]methyl] acetate (PubChem CID 130430341) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is [[1-(3,5-dimethylphenyl)cyclopentyl]-[(3S)-9-hydroxy-2,3-dimethyl-1,8-dioxo-3,4-dihydropyrazino[1,2-c]pyrimidin-6-yl]methyl] acetate.
| Compound Name | [[1-(3,5-dimethylphenyl)cyclopentyl]-[(3S)-9-hydroxy-2,3-dimethyl-1,8-dioxo-3,4-dihydropyrazino[1,2-c]pyrimidin-6-yl]methyl] acetate |
|---|---|
| PubChem CID | 130430341 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [[1-(3,5-dimethylphenyl)cyclopentyl]-[(3S)-9-hydroxy-2,3-dimethyl-1,8-dioxo-3,4-dihydropyrazino[1,2-c]pyrimidin-6-yl]methyl] acetate |
| SMILES | CC(=O)OC(c1nc(=O)c(O)c2n1C[C@H](C)N(C)C2=O)C1(c2cc(C)cc(C)c2)CCCC1 |
| InChI | InChI=1S/C25H31N3O5/c1-14-10-15(2)12-18(11-14)25(8-6-7-9-25)21(33-17(4)29)22-26-23(31)20(30)19-24(32)27(5)16(3)13-28(19)22/h10-12,16,21,30H,6-9,13H2,1-5H3/t16-,21?/m0/s1 |
| InChIKey | GUNAPXGJRRWNAD-BJQOMGFOSA-N |
| XLogP | 3.16 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |