C23H22N4O2 — CID 130430524
N-[[2-cyano-7-(4-cyanophenyl)-1,3-dihydroisoindol-5-yl]methyl]oxane-4-carboxamide (PubChem CID 130430524) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[[2-cyano-7-(4-cyanophenyl)-1,3-dihydroisoindol-5-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[2-cyano-7-(4-cyanophenyl)-1,3-dihydroisoindol-5-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 130430524 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[[2-cyano-7-(4-cyanophenyl)-1,3-dihydroisoindol-5-yl]methyl]oxane-4-carboxamide |
| SMILES | N#Cc1ccc(-c2cc(CNC(=O)C3CCOCC3)cc3c2CN(C#N)C3)cc1 |
| InChI | InChI=1S/C23H22N4O2/c24-11-16-1-3-18(4-2-16)21-10-17(9-20-13-27(15-25)14-22(20)21)12-26-23(28)19-5-7-29-8-6-19/h1-4,9-10,19H,5-8,12-14H2,(H,26,28) |
| InChIKey | QJYWFRAIENJBOK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|